C10H19BF3KN2 — CID 106745621
potassium trifluoro-[3-[methyl-(1-methylpiperidin-4-yl)amino]prop-1-en-2-yl]boranuide (PubChem CID 106745621) has the molecular formula C10H19BF3KN2 and a molecular weight of 274.18 g/mol. Its IUPAC name is potassium trifluoro-[3-[methyl-(1-methylpiperidin-4-yl)amino]prop-1-en-2-yl]boranuide.
| Compound Name | potassium trifluoro-[3-[methyl-(1-methylpiperidin-4-yl)amino]prop-1-en-2-yl]boranuide |
|---|---|
| PubChem CID | 106745621 |
| Molecular Formula | C10H19BF3KN2 |
| Molecular Weight | 274.18 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | potassium trifluoro-[3-[methyl-(1-methylpiperidin-4-yl)amino]prop-1-en-2-yl]boranuide |
| SMILES | C=C(CN(C)C1CCN(C)CC1)[B-](F)(F)F.[K+] |
| InChI | InChI=1S/C10H19BF3N2.K/c1-9(11(12,13)14)8-16(3)10-4-6-15(2)7-5-10;/h10H,1,4-8H2,2-3H3;/q-1;+1 |
| InChIKey | OINDKTCSCIGNSK-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.18 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|