C8H16BF3N- — CID 106745676
3-[butan-2-yl(methyl)amino]prop-1-en-2-yl-trifluoroboranuide (PubChem CID 106745676) has the molecular formula C8H16BF3N- and a molecular weight of 194.03 g/mol. Its IUPAC name is 3-[butan-2-yl(methyl)amino]prop-1-en-2-yl-trifluoroboranuide.
| Compound Name | 3-[butan-2-yl(methyl)amino]prop-1-en-2-yl-trifluoroboranuide |
|---|---|
| PubChem CID | 106745676 |
| Molecular Formula | C8H16BF3N- |
| Molecular Weight | 194.03 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | 3-[butan-2-yl(methyl)amino]prop-1-en-2-yl-trifluoroboranuide |
| SMILES | C=C(CN(C)C(C)CC)[B-](F)(F)F |
| InChI | InChI=1S/C8H16BF3N/c1-5-8(3)13(4)6-7(2)9(10,11)12/h8H,2,5-6H2,1,3-4H3/q-1 |
| InChIKey | PWMNZNPCCFOXKQ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.03 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|