About 3-[(1,1-dioxothiolan-3-yl)-methylamino]prop-1-en-2-yl-trifluoroboranuide
3-[(1,1-dioxothiolan-3-yl)-methylamino]prop-1-en-2-yl-trifluoroboranuide (PubChem CID 106745764) has the molecular formula C8H14BF3NO2S-
and a molecular weight of 256.08 g/mol. Its IUPAC name is 3-[(1,1-dioxothiolan-3-yl)-methylamino]prop-1-en-2-yl-trifluoroboranuide.
Molecular Properties
| Compound Name | 3-[(1,1-dioxothiolan-3-yl)-methylamino]prop-1-en-2-yl-trifluoroboranuide |
| PubChem CID | 106745764 |
| Molecular Formula | C8H14BF3NO2S- |
| Molecular Weight | 256.08 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | 3-[(1,1-dioxothiolan-3-yl)-methylamino]prop-1-en-2-yl-trifluoroboranuide |
| SMILES | C=C(CN(C)C1CCS(=O)(=O)C1)[B-](F)(F)F |
| InChI | InChI=1S/C8H14BF3NO2S/c1-7(9(10,11)12)5-13(2)8-3-4-16(14,15)6-8/h8H,1,3-6H2,2H3/q-1 |
| InChIKey | QZAOTMLPWSVMGD-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.08 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3-[(1,1-dioxothiolan-3-yl)-methylamino]prop-1-en-2-yl-trifluoroboranuide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1,1-dioxothiolan-3-yl)-methylamino]prop-1-en-2-yl-trifluoroboranuide?
The IUPAC name of 3-[(1,1-dioxothiolan-3-yl)-methylamino]prop-1-en-2-yl-trifluoroboranuide (CID 106745764) is 3-[(1,1-dioxothiolan-3-yl)-methylamino]prop-1-en-2-yl-trifluoroboranuide.
What is the SMILES notation for 3-[(1,1-dioxothiolan-3-yl)-methylamino]prop-1-en-2-yl-trifluoroboranuide?
The canonical SMILES for 3-[(1,1-dioxothiolan-3-yl)-methylamino]prop-1-en-2-yl-trifluoroboranuide is C=C(CN(C)C1CCS(=O)(=O)C1)[B-](F)(F)F.
What is the InChIKey of 3-[(1,1-dioxothiolan-3-yl)-methylamino]prop-1-en-2-yl-trifluoroboranuide?
The InChIKey is QZAOTMLPWSVMGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14BF3NO2S/c1-7(9(10,11)12)5-13(2)8-3-4-16(14,15)6-8/h8H,1,3-6H2,2H3/q-1.
What are the key properties of 3-[(1,1-dioxothiolan-3-yl)-methylamino]prop-1-en-2-yl-trifluoroboranuide?
3-[(1,1-dioxothiolan-3-yl)-methylamino]prop-1-en-2-yl-trifluoroboranuide has a molecular weight of 256.08 g/mol, XLogP of 1.05, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1,1-dioxothiolan-3-yl)-methylamino]prop-1-en-2-yl-trifluoroboranuide is sourced from PubChem (CID 106745764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).