C11H18BF3N- — CID 106746132
3-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl)prop-1-en-2-yl-trifluoroboranuide (PubChem CID 106746132) has the molecular formula C11H18BF3N- and a molecular weight of 232.08 g/mol. Its IUPAC name is 3-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl)prop-1-en-2-yl-trifluoroboranuide.
| Compound Name | 3-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl)prop-1-en-2-yl-trifluoroboranuide |
|---|---|
| PubChem CID | 106746132 |
| Molecular Formula | C11H18BF3N- |
| Molecular Weight | 232.08 g/mol |
| Exact Mass | 232.15 |
| IUPAC Name | 3-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl)prop-1-en-2-yl-trifluoroboranuide |
| SMILES | C=C(CN1CCCC2CCCC21)[B-](F)(F)F |
| InChI | InChI=1S/C11H18BF3N/c1-9(12(13,14)15)8-16-7-3-5-10-4-2-6-11(10)16/h10-11H,1-8H2/q-1 |
| InChIKey | QYEAKVDXPWRJSS-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.08 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|