C22H28ClN5O7S2 — CID 10674633
N-(3-methyl-5-sulfamoyl-1,3,4-thiadiazol-2-ylidene)-2-[4-phenyl-2,6-di(propan-2-yl)pyridin-1-ium-1-yl]acetamide perchlorate (PubChem CID 10674633) has the molecular formula C22H28ClN5O7S2 and a molecular weight of 574.08 g/mol. Its IUPAC name is N-(3-methyl-5-sulfamoyl-1,3,4-thiadiazol-2-ylidene)-2-[4-phenyl-2,6-di(propan-2-yl)pyridin-1-ium-1-yl]acetamide perchlorate.
| Compound Name | N-(3-methyl-5-sulfamoyl-1,3,4-thiadiazol-2-ylidene)-2-[4-phenyl-2,6-di(propan-2-yl)pyridin-1-ium-1-yl]acetamide perchlorate |
|---|---|
| PubChem CID | 10674633 |
| Molecular Formula | C22H28ClN5O7S2 |
| Molecular Weight | 574.08 g/mol |
| Exact Mass | 573.11 |
| IUPAC Name | N-(3-methyl-5-sulfamoyl-1,3,4-thiadiazol-2-ylidene)-2-[4-phenyl-2,6-di(propan-2-yl)pyridin-1-ium-1-yl]acetamide perchlorate |
| SMILES | CC(C)c1cc(-c2ccccc2)cc(C(C)C)[n+]1CC(=O)/N=c1\sc(S(N)(=O)=O)nn1C.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C22H28N5O3S2.ClHO4/c1-14(2)18-11-17(16-9-7-6-8-10-16)12-19(15(3)4)27(18)13-20(28)24-21-26(5)25-22(31-21)32(23,29)30;2-1(3,4)5/h6-12,14-15H,13H2,1-5H3,(H2,23,29,30);(H,2,3,4,5)/q+1;/p-1/b24-21-; |
| InChIKey | XCVDBEJYMRAFHD-KKPJOBIBSA-M |
| XLogP | -2.30 |
| TPSA | 203.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.08 |
| LogP ≤ 5 | -2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|