C32H34N2O8 — CID 10674642
(2R,3R,4S)-4-(1,3-benzodioxol-5-yl)-1-[2-(4-carboxy-2,6-diethylanilino)-2-oxoethyl]-2-(4-methoxyphenyl)pyrrolidine-3-carboxylic acid (PubChem CID 10674642) has the molecular formula C32H34N2O8 and a molecular weight of 574.63 g/mol. Its IUPAC name is (2R,3R,4S)-4-(1,3-benzodioxol-5-yl)-1-[2-(4-carboxy-2,6-diethylanilino)-2-oxoethyl]-2-(4-methoxyphenyl)pyrrolidine-3-carboxylic acid.
| Compound Name | (2R,3R,4S)-4-(1,3-benzodioxol-5-yl)-1-[2-(4-carboxy-2,6-diethylanilino)-2-oxoethyl]-2-(4-methoxyphenyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 10674642 |
| Molecular Formula | C32H34N2O8 |
| Molecular Weight | 574.63 g/mol |
| Exact Mass | 574.23 |
| IUPAC Name | (2R,3R,4S)-4-(1,3-benzodioxol-5-yl)-1-[2-(4-carboxy-2,6-diethylanilino)-2-oxoethyl]-2-(4-methoxyphenyl)pyrrolidine-3-carboxylic acid |
| SMILES | CCc1cc(C(=O)O)cc(CC)c1NC(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1c1ccc(OC)cc1 |
| InChI | InChI=1S/C32H34N2O8/c1-4-18-12-22(31(36)37)13-19(5-2)29(18)33-27(35)16-34-15-24(21-8-11-25-26(14-21)42-17-41-25)28(32(38)39)30(34)20-6-9-23(40-3)10-7-20/h6-14,24,28,30H,4-5,15-17H2,1-3H3,(H,33,35)(H,36,37)(H,38,39)/t24-,28-,30+/m1/s1 |
| InChIKey | SRYQEUIBRIIYSG-MLWJCNIFSA-N |
| XLogP | 4.73 |
| TPSA | 134.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.63 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |