C13H17BF3O- — CID 106746550
trifluoro-[3-(5-methyl-2-propan-2-ylphenoxy)prop-1-en-2-yl]boranuide (PubChem CID 106746550) has the molecular formula C13H17BF3O- and a molecular weight of 257.08 g/mol. Its IUPAC name is trifluoro-[3-(5-methyl-2-propan-2-ylphenoxy)prop-1-en-2-yl]boranuide.
| Compound Name | trifluoro-[3-(5-methyl-2-propan-2-ylphenoxy)prop-1-en-2-yl]boranuide |
|---|---|
| PubChem CID | 106746550 |
| Molecular Formula | C13H17BF3O- |
| Molecular Weight | 257.08 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | trifluoro-[3-(5-methyl-2-propan-2-ylphenoxy)prop-1-en-2-yl]boranuide |
| SMILES | C=C(COc1cc(C)ccc1C(C)C)[B-](F)(F)F |
| InChI | InChI=1S/C13H17BF3O/c1-9(2)12-6-5-10(3)7-13(12)18-8-11(4)14(15,16)17/h5-7,9H,4,8H2,1-3H3/q-1 |
| InChIKey | IZJQVFIEGOFFFS-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.08 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|