C11H14BF3KN3S — CID 106746917
potassium 3-[(4,5-dicyclopropyl-1,2,4-triazol-3-yl)sulfanyl]prop-1-en-2-yl-trifluoroboranuide (PubChem CID 106746917) has the molecular formula C11H14BF3KN3S and a molecular weight of 327.23 g/mol. Its IUPAC name is potassium 3-[(4,5-dicyclopropyl-1,2,4-triazol-3-yl)sulfanyl]prop-1-en-2-yl-trifluoroboranuide.
| Compound Name | potassium 3-[(4,5-dicyclopropyl-1,2,4-triazol-3-yl)sulfanyl]prop-1-en-2-yl-trifluoroboranuide |
|---|---|
| PubChem CID | 106746917 |
| Molecular Formula | C11H14BF3KN3S |
| Molecular Weight | 327.23 g/mol |
| Exact Mass | 327.06 |
| IUPAC Name | potassium 3-[(4,5-dicyclopropyl-1,2,4-triazol-3-yl)sulfanyl]prop-1-en-2-yl-trifluoroboranuide |
| SMILES | C=C(CSc1nnc(C2CC2)n1C1CC1)[B-](F)(F)F.[K+] |
| InChI | InChI=1S/C11H14BF3N3S.K/c1-7(12(13,14)15)6-19-11-17-16-10(8-2-3-8)18(11)9-4-5-9;/h8-9H,1-6H2;/q-1;+1 |
| InChIKey | YBQRJBCXIFRTGA-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.23 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|