About potassium 3-(3,4-dimethylphenyl)sulfanylprop-1-en-2-yl-trifluoroboranuide
potassium 3-(3,4-dimethylphenyl)sulfanylprop-1-en-2-yl-trifluoroboranuide (PubChem CID 106746947) has the molecular formula C11H13BF3KS
and a molecular weight of 284.20 g/mol. Its IUPAC name is potassium 3-(3,4-dimethylphenyl)sulfanylprop-1-en-2-yl-trifluoroboranuide.
Molecular Properties
| Compound Name | potassium 3-(3,4-dimethylphenyl)sulfanylprop-1-en-2-yl-trifluoroboranuide |
| PubChem CID | 106746947 |
| Molecular Formula | C11H13BF3KS |
| Molecular Weight | 284.20 g/mol |
| Exact Mass | 284.04 |
| IUPAC Name | potassium 3-(3,4-dimethylphenyl)sulfanylprop-1-en-2-yl-trifluoroboranuide |
| SMILES | C=C(CSc1ccc(C)c(C)c1)[B-](F)(F)F.[K+] |
| InChI | InChI=1S/C11H13BF3S.K/c1-8-4-5-11(6-9(8)2)16-7-10(3)12(13,14)15;/h4-6H,3,7H2,1-2H3;/q-1;+1 |
| InChIKey | OBOYIGOCWDQYJI-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.20 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze potassium 3-(3,4-dimethylphenyl)sulfanylprop-1-en-2-yl-trifluoroboranuide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium 3-(3,4-dimethylphenyl)sulfanylprop-1-en-2-yl-trifluoroboranuide?
The IUPAC name of potassium 3-(3,4-dimethylphenyl)sulfanylprop-1-en-2-yl-trifluoroboranuide (CID 106746947) is potassium 3-(3,4-dimethylphenyl)sulfanylprop-1-en-2-yl-trifluoroboranuide.
What is the SMILES notation for potassium 3-(3,4-dimethylphenyl)sulfanylprop-1-en-2-yl-trifluoroboranuide?
The canonical SMILES for potassium 3-(3,4-dimethylphenyl)sulfanylprop-1-en-2-yl-trifluoroboranuide is C=C(CSc1ccc(C)c(C)c1)[B-](F)(F)F.[K+].
What is the InChIKey of potassium 3-(3,4-dimethylphenyl)sulfanylprop-1-en-2-yl-trifluoroboranuide?
The InChIKey is OBOYIGOCWDQYJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13BF3S.K/c1-8-4-5-11(6-9(8)2)16-7-10(3)12(13,14)15;/h4-6H,3,7H2,1-2H3;/q-1;+1.
What are the key properties of potassium 3-(3,4-dimethylphenyl)sulfanylprop-1-en-2-yl-trifluoroboranuide?
potassium 3-(3,4-dimethylphenyl)sulfanylprop-1-en-2-yl-trifluoroboranuide has a molecular weight of 284.20 g/mol, XLogP of 1.34, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for potassium 3-(3,4-dimethylphenyl)sulfanylprop-1-en-2-yl-trifluoroboranuide is sourced from PubChem (CID 106746947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).