About trifluoro-[3-(4,5,6-trimethylpyrimidin-2-yl)sulfanylprop-1-en-2-yl]boranuide
trifluoro-[3-(4,5,6-trimethylpyrimidin-2-yl)sulfanylprop-1-en-2-yl]boranuide (PubChem CID 106747056) has the molecular formula C10H13BF3N2S-
and a molecular weight of 261.10 g/mol. Its IUPAC name is trifluoro-[3-(4,5,6-trimethylpyrimidin-2-yl)sulfanylprop-1-en-2-yl]boranuide.
Molecular Properties
| Compound Name | trifluoro-[3-(4,5,6-trimethylpyrimidin-2-yl)sulfanylprop-1-en-2-yl]boranuide |
| PubChem CID | 106747056 |
| Molecular Formula | C10H13BF3N2S- |
| Molecular Weight | 261.10 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | trifluoro-[3-(4,5,6-trimethylpyrimidin-2-yl)sulfanylprop-1-en-2-yl]boranuide |
| SMILES | C=C(CSc1nc(C)c(C)c(C)n1)[B-](F)(F)F |
| InChI | InChI=1S/C10H13BF3N2S/c1-6(11(12,13)14)5-17-10-15-8(3)7(2)9(4)16-10/h1,5H2,2-4H3/q-1 |
| InChIKey | ZIXPSYITWLZYPK-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.10 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze trifluoro-[3-(4,5,6-trimethylpyrimidin-2-yl)sulfanylprop-1-en-2-yl]boranuide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trifluoro-[3-(4,5,6-trimethylpyrimidin-2-yl)sulfanylprop-1-en-2-yl]boranuide?
The IUPAC name of trifluoro-[3-(4,5,6-trimethylpyrimidin-2-yl)sulfanylprop-1-en-2-yl]boranuide (CID 106747056) is trifluoro-[3-(4,5,6-trimethylpyrimidin-2-yl)sulfanylprop-1-en-2-yl]boranuide.
What is the SMILES notation for trifluoro-[3-(4,5,6-trimethylpyrimidin-2-yl)sulfanylprop-1-en-2-yl]boranuide?
The canonical SMILES for trifluoro-[3-(4,5,6-trimethylpyrimidin-2-yl)sulfanylprop-1-en-2-yl]boranuide is C=C(CSc1nc(C)c(C)c(C)n1)[B-](F)(F)F.
What is the InChIKey of trifluoro-[3-(4,5,6-trimethylpyrimidin-2-yl)sulfanylprop-1-en-2-yl]boranuide?
The InChIKey is ZIXPSYITWLZYPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13BF3N2S/c1-6(11(12,13)14)5-17-10-15-8(3)7(2)9(4)16-10/h1,5H2,2-4H3/q-1.
What are the key properties of trifluoro-[3-(4,5,6-trimethylpyrimidin-2-yl)sulfanylprop-1-en-2-yl]boranuide?
trifluoro-[3-(4,5,6-trimethylpyrimidin-2-yl)sulfanylprop-1-en-2-yl]boranuide has a molecular weight of 261.10 g/mol, XLogP of 3.44, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for trifluoro-[3-(4,5,6-trimethylpyrimidin-2-yl)sulfanylprop-1-en-2-yl]boranuide is sourced from PubChem (CID 106747056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).