C33H58O6Si — CID 10674736
(E,3S,4R,5S)-5-[(4-methoxyphenyl)methoxy]-7-[(1R,3R,4R)-3-methoxy-4-tri(propan-2-yl)silyloxycyclohexyl]-4,6-dimethylhept-6-ene-1,3-diol (PubChem CID 10674736) has the molecular formula C33H58O6Si and a molecular weight of 578.91 g/mol. Its IUPAC name is (E,3S,4R,5S)-5-[(4-methoxyphenyl)methoxy]-7-[(1R,3R,4R)-3-methoxy-4-tri(propan-2-yl)silyloxycyclohexyl]-4,6-dimethylhept-6-ene-1,3-diol.
| Compound Name | (E,3S,4R,5S)-5-[(4-methoxyphenyl)methoxy]-7-[(1R,3R,4R)-3-methoxy-4-tri(propan-2-yl)silyloxycyclohexyl]-4,6-dimethylhept-6-ene-1,3-diol |
|---|---|
| PubChem CID | 10674736 |
| Molecular Formula | C33H58O6Si |
| Molecular Weight | 578.91 g/mol |
| Exact Mass | 578.40 |
| IUPAC Name | (E,3S,4R,5S)-5-[(4-methoxyphenyl)methoxy]-7-[(1R,3R,4R)-3-methoxy-4-tri(propan-2-yl)silyloxycyclohexyl]-4,6-dimethylhept-6-ene-1,3-diol |
| SMILES | COc1ccc(CO[C@H](/C(C)=C/[C@@H]2CC[C@@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@H](OC)C2)[C@H](C)[C@@H](O)CCO)cc1 |
| InChI | InChI=1S/C33H58O6Si/c1-22(2)40(23(3)4,24(5)6)39-31-16-13-28(20-32(31)37-10)19-25(7)33(26(8)30(35)17-18-34)38-21-27-11-14-29(36-9)15-12-27/h11-12,14-15,19,22-24,26,28,30-35H,13,16-18,20-21H2,1-10H3/b25-19+/t26-,28+,30+,31-,32-,33-/m1/s1 |
| InChIKey | KRHVJUCZGCKQLO-VWBUXLMQSA-N |
| XLogP | 7.28 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.91 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|