C32H60O5Si2 — CID 10674766
(2S,4Z)-2-[(1R,2R)-2-[(E,1R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-1-(2-trimethylsilylethoxymethoxy)non-2-enyl]cyclopropyl]-3,6,7,8-tetrahydro-2H-oxonin-9-one (PubChem CID 10674766) has the molecular formula C32H60O5Si2 and a molecular weight of 581.00 g/mol. Its IUPAC name is (2S,4Z)-2-[(1R,2R)-2-[(E,1R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-1-(2-trimethylsilylethoxymethoxy)non-2-enyl]cyclopropyl]-3,6,7,8-tetrahydro-2H-oxonin-9-one.
| Compound Name | (2S,4Z)-2-[(1R,2R)-2-[(E,1R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-1-(2-trimethylsilylethoxymethoxy)non-2-enyl]cyclopropyl]-3,6,7,8-tetrahydro-2H-oxonin-9-one |
|---|---|
| PubChem CID | 10674766 |
| Molecular Formula | C32H60O5Si2 |
| Molecular Weight | 581.00 g/mol |
| Exact Mass | 580.40 |
| IUPAC Name | (2S,4Z)-2-[(1R,2R)-2-[(E,1R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-1-(2-trimethylsilylethoxymethoxy)non-2-enyl]cyclopropyl]-3,6,7,8-tetrahydro-2H-oxonin-9-one |
| SMILES | CCCCC[C@H](/C=C/[C@@H](OCOCC[Si](C)(C)C)[C@@H]1C[C@H]1[C@@H]1C/C=C\CCCC(=O)O1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C32H60O5Si2/c1-10-11-14-17-26(37-39(8,9)32(2,3)4)20-21-29(35-25-34-22-23-38(5,6)7)27-24-28(27)30-18-15-12-13-16-19-31(33)36-30/h12,15,20-21,26-30H,10-11,13-14,16-19,22-25H2,1-9H3/b15-12-,21-20+/t26-,27-,28-,29-,30+/m1/s1 |
| InChIKey | LUEXZOAIOGEVJH-QKRPXHLJSA-N |
| XLogP | 8.89 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.00 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|