C33H39N5O5 — CID 10674840
2-[4-(dimethylamino)phenyl]-N-[2-hydroxy-3-[4-(2-propan-2-yloxyphenyl)piperazin-1-yl]propyl]-1,3-dioxoisoindole-5-carboxamide (PubChem CID 10674840) has the molecular formula C33H39N5O5 and a molecular weight of 585.71 g/mol. Its IUPAC name is 2-[4-(dimethylamino)phenyl]-N-[2-hydroxy-3-[4-(2-propan-2-yloxyphenyl)piperazin-1-yl]propyl]-1,3-dioxoisoindole-5-carboxamide.
| Compound Name | 2-[4-(dimethylamino)phenyl]-N-[2-hydroxy-3-[4-(2-propan-2-yloxyphenyl)piperazin-1-yl]propyl]-1,3-dioxoisoindole-5-carboxamide |
|---|---|
| PubChem CID | 10674840 |
| Molecular Formula | C33H39N5O5 |
| Molecular Weight | 585.71 g/mol |
| Exact Mass | 585.30 |
| IUPAC Name | 2-[4-(dimethylamino)phenyl]-N-[2-hydroxy-3-[4-(2-propan-2-yloxyphenyl)piperazin-1-yl]propyl]-1,3-dioxoisoindole-5-carboxamide |
| SMILES | CC(C)Oc1ccccc1N1CCN(CC(O)CNC(=O)c2ccc3c(c2)C(=O)N(c2ccc(N(C)C)cc2)C3=O)CC1 |
| InChI | InChI=1S/C33H39N5O5/c1-22(2)43-30-8-6-5-7-29(30)37-17-15-36(16-18-37)21-26(39)20-34-31(40)23-9-14-27-28(19-23)33(42)38(32(27)41)25-12-10-24(11-13-25)35(3)4/h5-14,19,22,26,39H,15-18,20-21H2,1-4H3,(H,34,40) |
| InChIKey | LQTJOPPTSIYEES-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 105.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.71 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|