C10H13N5S — CID 106748818
4-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]benzene-1,2-diamine (PubChem CID 106748818) has the molecular formula C10H13N5S and a molecular weight of 235.32 g/mol. Its IUPAC name is 4-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]benzene-1,2-diamine.
| Compound Name | 4-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 106748818 |
| Molecular Formula | C10H13N5S |
| Molecular Weight | 235.32 g/mol |
| Exact Mass | 235.09 |
| IUPAC Name | 4-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]benzene-1,2-diamine |
| SMILES | Cc1nnc(Sc2ccc(N)c(N)c2)n1C |
| InChI | InChI=1S/C10H13N5S/c1-6-13-14-10(15(6)2)16-7-3-4-8(11)9(12)5-7/h3-5H,11-12H2,1-2H3 |
| InChIKey | NMCRNUFCFNUKHZ-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 82.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.32 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|