C14H22N4O2 — CID 106749914
1-N-(4-aminocyclohexyl)-1-N-ethyl-4-nitrobenzene-1,3-diamine (PubChem CID 106749914) has the molecular formula C14H22N4O2 and a molecular weight of 278.36 g/mol. Its IUPAC name is 1-N-(4-aminocyclohexyl)-1-N-ethyl-4-nitrobenzene-1,3-diamine.
| Compound Name | 1-N-(4-aminocyclohexyl)-1-N-ethyl-4-nitrobenzene-1,3-diamine |
|---|---|
| PubChem CID | 106749914 |
| Molecular Formula | C14H22N4O2 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | 1-N-(4-aminocyclohexyl)-1-N-ethyl-4-nitrobenzene-1,3-diamine |
| SMILES | CCN(c1ccc([N+](=O)[O-])c(N)c1)C1CCC(N)CC1 |
| InChI | InChI=1S/C14H22N4O2/c1-2-17(11-5-3-10(15)4-6-11)12-7-8-14(18(19)20)13(16)9-12/h7-11H,2-6,15-16H2,1H3 |
| InChIKey | JBLBTMLBENNWNN-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 98.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|