C35H38N4O5 — CID 10675002
1-O-benzyl 6-O-[1-[2-(dimethylamino)ethylcarbamoyl]-5,6-dimethylpyrido[4,3-b]carbazol-9-yl] hexanedioate (PubChem CID 10675002) has the molecular formula C35H38N4O5 and a molecular weight of 594.71 g/mol. Its IUPAC name is 1-O-benzyl 6-O-[1-[2-(dimethylamino)ethylcarbamoyl]-5,6-dimethylpyrido[4,3-b]carbazol-9-yl] hexanedioate.
| Compound Name | 1-O-benzyl 6-O-[1-[2-(dimethylamino)ethylcarbamoyl]-5,6-dimethylpyrido[4,3-b]carbazol-9-yl] hexanedioate |
|---|---|
| PubChem CID | 10675002 |
| Molecular Formula | C35H38N4O5 |
| Molecular Weight | 594.71 g/mol |
| Exact Mass | 594.28 |
| IUPAC Name | 1-O-benzyl 6-O-[1-[2-(dimethylamino)ethylcarbamoyl]-5,6-dimethylpyrido[4,3-b]carbazol-9-yl] hexanedioate |
| SMILES | Cc1c2ccnc(C(=O)NCCN(C)C)c2cc2c3cc(OC(=O)CCCCC(=O)OCc4ccccc4)ccc3n(C)c12 |
| InChI | InChI=1S/C35H38N4O5/c1-23-26-16-17-36-33(35(42)37-18-19-38(2)3)28(26)21-29-27-20-25(14-15-30(27)39(4)34(23)29)44-32(41)13-9-8-12-31(40)43-22-24-10-6-5-7-11-24/h5-7,10-11,14-17,20-21H,8-9,12-13,18-19,22H2,1-4H3,(H,37,42) |
| InChIKey | AERHULSJDMNIAZ-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 102.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.71 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|