C13H21N3 — CID 106750210
4-(azocan-1-yl)benzene-1,2-diamine (PubChem CID 106750210) has the molecular formula C13H21N3 and a molecular weight of 219.33 g/mol. Its IUPAC name is 4-(azocan-1-yl)benzene-1,2-diamine.
| Compound Name | 4-(azocan-1-yl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 106750210 |
| Molecular Formula | C13H21N3 |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.17 |
| IUPAC Name | 4-(azocan-1-yl)benzene-1,2-diamine |
| SMILES | Nc1ccc(N2CCCCCCC2)cc1N |
| InChI | InChI=1S/C13H21N3/c14-12-7-6-11(10-13(12)15)16-8-4-2-1-3-5-9-16/h6-7,10H,1-5,8-9,14-15H2 |
| InChIKey | TZOAIJKGCNBNCZ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|