About 4-N-(oxan-4-yl)benzene-1,2,4-triamine
4-N-(oxan-4-yl)benzene-1,2,4-triamine (PubChem CID 106750455) has the molecular formula C11H17N3O
and a molecular weight of 207.28 g/mol. Its IUPAC name is 4-N-(oxan-4-yl)benzene-1,2,4-triamine.
Molecular Properties
| Compound Name | 4-N-(oxan-4-yl)benzene-1,2,4-triamine |
| PubChem CID | 106750455 |
| Molecular Formula | C11H17N3O |
| Molecular Weight | 207.28 g/mol |
| Exact Mass | 207.14 |
| IUPAC Name | 4-N-(oxan-4-yl)benzene-1,2,4-triamine |
| SMILES | Nc1ccc(NC2CCOCC2)cc1N |
| InChI | InChI=1S/C11H17N3O/c12-10-2-1-9(7-11(10)13)14-8-3-5-15-6-4-8/h1-2,7-8,14H,3-6,12-13H2 |
| InChIKey | ISIJDWHQKWPFTM-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 73.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.28 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-N-(oxan-4-yl)benzene-1,2,4-triamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N-(oxan-4-yl)benzene-1,2,4-triamine?
The IUPAC name of 4-N-(oxan-4-yl)benzene-1,2,4-triamine (CID 106750455) is 4-N-(oxan-4-yl)benzene-1,2,4-triamine.
What is the SMILES notation for 4-N-(oxan-4-yl)benzene-1,2,4-triamine?
The canonical SMILES for 4-N-(oxan-4-yl)benzene-1,2,4-triamine is Nc1ccc(NC2CCOCC2)cc1N.
What is the InChIKey of 4-N-(oxan-4-yl)benzene-1,2,4-triamine?
The InChIKey is ISIJDWHQKWPFTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N3O/c12-10-2-1-9(7-11(10)13)14-8-3-5-15-6-4-8/h1-2,7-8,14H,3-6,12-13H2.
What are the key properties of 4-N-(oxan-4-yl)benzene-1,2,4-triamine?
4-N-(oxan-4-yl)benzene-1,2,4-triamine has a molecular weight of 207.28 g/mol, XLogP of 1.44, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N-(oxan-4-yl)benzene-1,2,4-triamine is sourced from PubChem (CID 106750455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).