C11H17N3O — CID 106750455
4-N-(oxan-4-yl)benzene-1,2,4-triamine (PubChem CID 106750455) has the molecular formula C11H17N3O and a molecular weight of 207.28 g/mol. Its IUPAC name is 4-N-(oxan-4-yl)benzene-1,2,4-triamine.
| Compound Name | 4-N-(oxan-4-yl)benzene-1,2,4-triamine |
|---|---|
| PubChem CID | 106750455 |
| Molecular Formula | C11H17N3O |
| Molecular Weight | 207.28 g/mol |
| Exact Mass | 207.14 |
| IUPAC Name | 4-N-(oxan-4-yl)benzene-1,2,4-triamine |
| SMILES | Nc1ccc(NC2CCOCC2)cc1N |
| InChI | InChI=1S/C11H17N3O/c12-10-2-1-9(7-11(10)13)14-8-3-5-15-6-4-8/h1-2,7-8,14H,3-6,12-13H2 |
| InChIKey | ISIJDWHQKWPFTM-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 73.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.28 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|