C34H30N8O2S2 — CID 10675710
4-[(Z)-(2-hydroxy-1,2-diphenylethylidene)amino]-3-[2-[4-[(Z)-(2-hydroxy-1,2-diphenylethylidene)amino]-5-sulfanylidene-1H-1,2,4-triazol-3-yl]ethyl]-1H-1,2,4-triazole-5-thione (PubChem CID 10675710) has the molecular formula C34H30N8O2S2 and a molecular weight of 646.80 g/mol. Its IUPAC name is 4-[(Z)-(2-hydroxy-1,2-diphenylethylidene)amino]-3-[2-[4-[(Z)-(2-hydroxy-1,2-diphenylethylidene)amino]-5-sulfanylidene-1H-1,2,4-triazol-3-yl]ethyl]-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[(Z)-(2-hydroxy-1,2-diphenylethylidene)amino]-3-[2-[4-[(Z)-(2-hydroxy-1,2-diphenylethylidene)amino]-5-sulfanylidene-1H-1,2,4-triazol-3-yl]ethyl]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 10675710 |
| Molecular Formula | C34H30N8O2S2 |
| Molecular Weight | 646.80 g/mol |
| Exact Mass | 646.19 |
| IUPAC Name | 4-[(Z)-(2-hydroxy-1,2-diphenylethylidene)amino]-3-[2-[4-[(Z)-(2-hydroxy-1,2-diphenylethylidene)amino]-5-sulfanylidene-1H-1,2,4-triazol-3-yl]ethyl]-1H-1,2,4-triazole-5-thione |
| SMILES | OC(/C(=N\n1c(CCc2n[nH]c(=S)n2/N=C(/c2ccccc2)C(O)c2ccccc2)n[nH]c1=S)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C34H30N8O2S2/c43-31(25-17-9-3-10-18-25)29(23-13-5-1-6-14-23)39-41-27(35-37-33(41)45)21-22-28-36-38-34(46)42(28)40-30(24-15-7-2-8-16-24)32(44)26-19-11-4-12-20-26/h1-20,31-32,43-44H,21-22H2,(H,37,45)(H,38,46)/b39-29-,40-30- |
| InChIKey | LNUADEFRLSOOGL-LDIFZFAOSA-N |
| XLogP | 5.95 |
| TPSA | 132.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.80 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|