C41H45O5P — CID 10675740
(3aR,8aR)-2,2-dimethyl-4,4,8,8-tetraphenyl-6-[[(1R,2R,4S)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]-3a,8a-dihydro-[1,3]dioxolo[4,5-e][1,3,2]dioxaphosphepine (PubChem CID 10675740) has the molecular formula C41H45O5P and a molecular weight of 648.78 g/mol. Its IUPAC name is (3aR,8aR)-2,2-dimethyl-4,4,8,8-tetraphenyl-6-[[(1R,2R,4S)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]-3a,8a-dihydro-[1,3]dioxolo[4,5-e][1,3,2]dioxaphosphepine.
| Compound Name | (3aR,8aR)-2,2-dimethyl-4,4,8,8-tetraphenyl-6-[[(1R,2R,4S)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]-3a,8a-dihydro-[1,3]dioxolo[4,5-e][1,3,2]dioxaphosphepine |
|---|---|
| PubChem CID | 10675740 |
| Molecular Formula | C41H45O5P |
| Molecular Weight | 648.78 g/mol |
| Exact Mass | 648.30 |
| IUPAC Name | (3aR,8aR)-2,2-dimethyl-4,4,8,8-tetraphenyl-6-[[(1R,2R,4S)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]-3a,8a-dihydro-[1,3]dioxolo[4,5-e][1,3,2]dioxaphosphepine |
| SMILES | CC1(C)O[C@@H]2[C@@H](O1)C(c1ccccc1)(c1ccccc1)OP(O[C@H]1C(C)(C)[C@H]3CC[C@]1(C)C3)OC2(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C41H45O5P/c1-37(2)33-26-27-39(5,28-33)36(37)44-47-45-40(29-18-10-6-11-19-29,30-20-12-7-13-21-30)34-35(43-38(3,4)42-34)41(46-47,31-22-14-8-15-23-31)32-24-16-9-17-25-32/h6-25,33-36H,26-28H2,1-5H3/t33-,34+,35+,36-,39+/m0/s1 |
| InChIKey | TUZXNYNTVOOSCF-VQHAREEXSA-N |
| XLogP | 9.90 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.78 |
| LogP ≤ 5 | 9.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|