C38H50N4O6 — CID 10675839
benzyl 2-[[(1S,2R)-1-[[(2S)-2-[[(2S)-2-amino-3-methylbutanoyl]amino]-3-phenylpropanoyl]amino]-2-phenylmethoxypropyl]carbamoyl]-4-methylpentanoate (PubChem CID 10675839) has the molecular formula C38H50N4O6 and a molecular weight of 658.84 g/mol. Its IUPAC name is benzyl 2-[[(1S,2R)-1-[[(2S)-2-[[(2S)-2-amino-3-methylbutanoyl]amino]-3-phenylpropanoyl]amino]-2-phenylmethoxypropyl]carbamoyl]-4-methylpentanoate.
| Compound Name | benzyl 2-[[(1S,2R)-1-[[(2S)-2-[[(2S)-2-amino-3-methylbutanoyl]amino]-3-phenylpropanoyl]amino]-2-phenylmethoxypropyl]carbamoyl]-4-methylpentanoate |
|---|---|
| PubChem CID | 10675839 |
| Molecular Formula | C38H50N4O6 |
| Molecular Weight | 658.84 g/mol |
| Exact Mass | 658.37 |
| IUPAC Name | benzyl 2-[[(1S,2R)-1-[[(2S)-2-[[(2S)-2-amino-3-methylbutanoyl]amino]-3-phenylpropanoyl]amino]-2-phenylmethoxypropyl]carbamoyl]-4-methylpentanoate |
| SMILES | CC(C)CC(C(=O)N[C@@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H](N)C(C)C)[C@@H](C)OCc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C38H50N4O6/c1-25(2)21-31(38(46)48-24-30-19-13-8-14-20-30)35(43)41-34(27(5)47-23-29-17-11-7-12-18-29)42-36(44)32(22-28-15-9-6-10-16-28)40-37(45)33(39)26(3)4/h6-20,25-27,31-34H,21-24,39H2,1-5H3,(H,40,45)(H,41,43)(H,42,44)/t27-,31?,32+,33+,34+/m1/s1 |
| InChIKey | OQSZSRAXCHPFTN-FXLGBRQISA-N |
| XLogP | 4.27 |
| TPSA | 148.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.84 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|