C41H42O6S — CID 10675877
(2R,3S,4S,5R,6S)-5-[(4-methoxyphenyl)methoxy]-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-6-phenylsulfanyloxane (PubChem CID 10675877) has the molecular formula C41H42O6S and a molecular weight of 662.85 g/mol. Its IUPAC name is (2R,3S,4S,5R,6S)-5-[(4-methoxyphenyl)methoxy]-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-6-phenylsulfanyloxane.
| Compound Name | (2R,3S,4S,5R,6S)-5-[(4-methoxyphenyl)methoxy]-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-6-phenylsulfanyloxane |
|---|---|
| PubChem CID | 10675877 |
| Molecular Formula | C41H42O6S |
| Molecular Weight | 662.85 g/mol |
| Exact Mass | 662.27 |
| IUPAC Name | (2R,3S,4S,5R,6S)-5-[(4-methoxyphenyl)methoxy]-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-6-phenylsulfanyloxane |
| SMILES | COc1ccc(CO[C@@H]2[C@@H](OCc3ccccc3)[C@@H](OCc3ccccc3)[C@@H](COCc3ccccc3)O[C@H]2Sc2ccccc2)cc1 |
| InChI | InChI=1S/C41H42O6S/c1-42-35-24-22-34(23-25-35)29-46-40-39(45-28-33-18-10-4-11-19-33)38(44-27-32-16-8-3-9-17-32)37(30-43-26-31-14-6-2-7-15-31)47-41(40)48-36-20-12-5-13-21-36/h2-25,37-41H,26-30H2,1H3/t37-,38+,39+,40-,41+/m1/s1 |
| InChIKey | DHRIUBUPNCNOTD-RSGFCBGISA-N |
| XLogP | 8.49 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.85 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |