C16H10F17NO5S2 — CID 10676062
2-(4-sulfamoylphenyl)ethyl 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonate (PubChem CID 10676062) has the molecular formula C16H10F17NO5S2 and a molecular weight of 683.36 g/mol. Its IUPAC name is 2-(4-sulfamoylphenyl)ethyl 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonate.
| Compound Name | 2-(4-sulfamoylphenyl)ethyl 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonate |
|---|---|
| PubChem CID | 10676062 |
| Molecular Formula | C16H10F17NO5S2 |
| Molecular Weight | 683.36 g/mol |
| Exact Mass | 682.97 |
| IUPAC Name | 2-(4-sulfamoylphenyl)ethyl 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonate |
| SMILES | NS(=O)(=O)c1ccc(CCOS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H10F17NO5S2/c17-9(18,11(21,22)13(25,26)15(29,30)31)10(19,20)12(23,24)14(27,28)16(32,33)41(37,38)39-6-5-7-1-3-8(4-2-7)40(34,35)36/h1-4H,5-6H2,(H2,34,35,36) |
| InChIKey | JAOOOLNFCYSKHW-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 103.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.36 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|