C17H29N3 — CID 106760888
2-(5-butan-2-yl-2-methylpiperazin-1-yl)-N,N-dimethylaniline (PubChem CID 106760888) has the molecular formula C17H29N3 and a molecular weight of 275.44 g/mol. Its IUPAC name is 2-(5-butan-2-yl-2-methylpiperazin-1-yl)-N,N-dimethylaniline.
| Compound Name | 2-(5-butan-2-yl-2-methylpiperazin-1-yl)-N,N-dimethylaniline |
|---|---|
| PubChem CID | 106760888 |
| Molecular Formula | C17H29N3 |
| Molecular Weight | 275.44 g/mol |
| Exact Mass | 275.24 |
| IUPAC Name | 2-(5-butan-2-yl-2-methylpiperazin-1-yl)-N,N-dimethylaniline |
| SMILES | CCC(C)C1CN(c2ccccc2N(C)C)C(C)CN1 |
| InChI | InChI=1S/C17H29N3/c1-6-13(2)15-12-20(14(3)11-18-15)17-10-8-7-9-16(17)19(4)5/h7-10,13-15,18H,6,11-12H2,1-5H3 |
| InChIKey | JGVMZXFJXLTKSJ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.44 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |