C16H16BrClFN — CID 106762466
1-(4-bromo-3-chloro-2-fluorophenyl)-2-(3,4-dimethylphenyl)ethanamine (PubChem CID 106762466) has the molecular formula C16H16BrClFN and a molecular weight of 356.67 g/mol. Its IUPAC name is 1-(4-bromo-3-chloro-2-fluorophenyl)-2-(3,4-dimethylphenyl)ethanamine.
| Compound Name | 1-(4-bromo-3-chloro-2-fluorophenyl)-2-(3,4-dimethylphenyl)ethanamine |
|---|---|
| PubChem CID | 106762466 |
| Molecular Formula | C16H16BrClFN |
| Molecular Weight | 356.67 g/mol |
| Exact Mass | 355.01 |
| IUPAC Name | 1-(4-bromo-3-chloro-2-fluorophenyl)-2-(3,4-dimethylphenyl)ethanamine |
| SMILES | Cc1ccc(CC(N)c2ccc(Br)c(Cl)c2F)cc1C |
| InChI | InChI=1S/C16H16BrClFN/c1-9-3-4-11(7-10(9)2)8-14(20)12-5-6-13(17)15(18)16(12)19/h3-7,14H,8,20H2,1-2H3 |
| InChIKey | JESVBWQQQJABSK-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.67 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|