C11H14BrClFN — CID 106763461
3-(4-bromo-3-chloro-2-fluorophenyl)-N,2-dimethylpropan-1-amine (PubChem CID 106763461) has the molecular formula C11H14BrClFN and a molecular weight of 294.60 g/mol. Its IUPAC name is 3-(4-bromo-3-chloro-2-fluorophenyl)-N,2-dimethylpropan-1-amine.
| Compound Name | 3-(4-bromo-3-chloro-2-fluorophenyl)-N,2-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 106763461 |
| Molecular Formula | C11H14BrClFN |
| Molecular Weight | 294.60 g/mol |
| Exact Mass | 293.00 |
| IUPAC Name | 3-(4-bromo-3-chloro-2-fluorophenyl)-N,2-dimethylpropan-1-amine |
| SMILES | CNCC(C)Cc1ccc(Br)c(Cl)c1F |
| InChI | InChI=1S/C11H14BrClFN/c1-7(6-15-2)5-8-3-4-9(12)10(13)11(8)14/h3-4,7,15H,5-6H2,1-2H3 |
| InChIKey | AUCVOVRWUQRNCR-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.60 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|