C11H6BrClFNOS — CID 106764329
(4-bromo-3-chloro-2-fluorophenyl)-(4-methyl-1,3-thiazol-5-yl)methanone (PubChem CID 106764329) has the molecular formula C11H6BrClFNOS and a molecular weight of 334.60 g/mol. Its IUPAC name is (4-bromo-3-chloro-2-fluorophenyl)-(4-methyl-1,3-thiazol-5-yl)methanone.
| Compound Name | (4-bromo-3-chloro-2-fluorophenyl)-(4-methyl-1,3-thiazol-5-yl)methanone |
|---|---|
| PubChem CID | 106764329 |
| Molecular Formula | C11H6BrClFNOS |
| Molecular Weight | 334.60 g/mol |
| Exact Mass | 332.90 |
| IUPAC Name | (4-bromo-3-chloro-2-fluorophenyl)-(4-methyl-1,3-thiazol-5-yl)methanone |
| SMILES | Cc1ncsc1C(=O)c1ccc(Br)c(Cl)c1F |
| InChI | InChI=1S/C11H6BrClFNOS/c1-5-11(17-4-15-5)10(16)6-2-3-7(12)8(13)9(6)14/h2-4H,1H3 |
| InChIKey | HNOZHJOZQILIJI-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.60 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|