C29H15F10IN2O2 — CID 10676482
[5-[[5-[hydroxy-(2,3,4,5,6-pentafluorophenyl)methyl]-1H-pyrrol-2-yl]-(2,3,4,5,6-pentafluorophenyl)methyl]-1H-pyrrol-2-yl]-(4-iodophenyl)methanol (PubChem CID 10676482) has the molecular formula C29H15F10IN2O2 and a molecular weight of 740.33 g/mol. Its IUPAC name is [5-[[5-[hydroxy-(2,3,4,5,6-pentafluorophenyl)methyl]-1H-pyrrol-2-yl]-(2,3,4,5,6-pentafluorophenyl)methyl]-1H-pyrrol-2-yl]-(4-iodophenyl)methanol.
| Compound Name | [5-[[5-[hydroxy-(2,3,4,5,6-pentafluorophenyl)methyl]-1H-pyrrol-2-yl]-(2,3,4,5,6-pentafluorophenyl)methyl]-1H-pyrrol-2-yl]-(4-iodophenyl)methanol |
|---|---|
| PubChem CID | 10676482 |
| Molecular Formula | C29H15F10IN2O2 |
| Molecular Weight | 740.33 g/mol |
| Exact Mass | 740.00 |
| IUPAC Name | [5-[[5-[hydroxy-(2,3,4,5,6-pentafluorophenyl)methyl]-1H-pyrrol-2-yl]-(2,3,4,5,6-pentafluorophenyl)methyl]-1H-pyrrol-2-yl]-(4-iodophenyl)methanol |
| SMILES | OC(c1ccc(I)cc1)c1ccc(C(c2ccc(C(O)c3c(F)c(F)c(F)c(F)c3F)[nH]2)c2c(F)c(F)c(F)c(F)c2F)[nH]1 |
| InChI | InChI=1S/C29H15F10IN2O2/c30-18-16(19(31)23(35)26(38)22(18)34)15(11-5-7-13(41-11)28(43)9-1-3-10(40)4-2-9)12-6-8-14(42-12)29(44)17-20(32)24(36)27(39)25(37)21(17)33/h1-8,15,28-29,41-44H |
| InChIKey | JPXPGOHQXMAMFY-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 72.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.33 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|