About 2-ethylsulfanyl-4,6-bis(4-methoxyphenyl)pyridine-3-carbonitrile
2-ethylsulfanyl-4,6-bis(4-methoxyphenyl)pyridine-3-carbonitrile (PubChem CID 1067657) has the molecular formula C22H20N2O2S
and a molecular weight of 376.48 g/mol. Its IUPAC name is 2-ethylsulfanyl-4,6-bis(4-methoxyphenyl)pyridine-3-carbonitrile.
Molecular Properties
| Compound Name | 2-ethylsulfanyl-4,6-bis(4-methoxyphenyl)pyridine-3-carbonitrile |
| PubChem CID | 1067657 |
| Molecular Formula | C22H20N2O2S |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | 2-ethylsulfanyl-4,6-bis(4-methoxyphenyl)pyridine-3-carbonitrile |
| SMILES | CCSc1nc(-c2ccc(OC)cc2)cc(-c2ccc(OC)cc2)c1C#N |
| InChI | InChI=1S/C22H20N2O2S/c1-4-27-22-20(14-23)19(15-5-9-17(25-2)10-6-15)13-21(24-22)16-7-11-18(26-3)12-8-16/h5-13H,4H2,1-3H3 |
| InChIKey | JBJMSTRDPYODLV-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 55.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het_thio_pyr_A(3)', 'substructure': 'N/A'} |
|---|
Analyze 2-ethylsulfanyl-4,6-bis(4-methoxyphenyl)pyridine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylsulfanyl-4,6-bis(4-methoxyphenyl)pyridine-3-carbonitrile?
The IUPAC name of 2-ethylsulfanyl-4,6-bis(4-methoxyphenyl)pyridine-3-carbonitrile (CID 1067657) is 2-ethylsulfanyl-4,6-bis(4-methoxyphenyl)pyridine-3-carbonitrile.
What is the SMILES notation for 2-ethylsulfanyl-4,6-bis(4-methoxyphenyl)pyridine-3-carbonitrile?
The canonical SMILES for 2-ethylsulfanyl-4,6-bis(4-methoxyphenyl)pyridine-3-carbonitrile is CCSc1nc(-c2ccc(OC)cc2)cc(-c2ccc(OC)cc2)c1C#N.
What is the InChIKey of 2-ethylsulfanyl-4,6-bis(4-methoxyphenyl)pyridine-3-carbonitrile?
The InChIKey is JBJMSTRDPYODLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20N2O2S/c1-4-27-22-20(14-23)19(15-5-9-17(25-2)10-6-15)13-21(24-22)16-7-11-18(26-3)12-8-16/h5-13H,4H2,1-3H3.
What are the key properties of 2-ethylsulfanyl-4,6-bis(4-methoxyphenyl)pyridine-3-carbonitrile?
2-ethylsulfanyl-4,6-bis(4-methoxyphenyl)pyridine-3-carbonitrile has a molecular weight of 376.48 g/mol, XLogP of 5.42, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylsulfanyl-4,6-bis(4-methoxyphenyl)pyridine-3-carbonitrile is sourced from PubChem (CID 1067657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).