C11H13ClF3N3O — CID 106767232
[1-[6-chloro-2-(trifluoromethyl)pyrimidin-4-yl]piperidin-3-yl]methanol (PubChem CID 106767232) has the molecular formula C11H13ClF3N3O and a molecular weight of 295.69 g/mol. Its IUPAC name is [1-[6-chloro-2-(trifluoromethyl)pyrimidin-4-yl]piperidin-3-yl]methanol.
| Compound Name | [1-[6-chloro-2-(trifluoromethyl)pyrimidin-4-yl]piperidin-3-yl]methanol |
|---|---|
| PubChem CID | 106767232 |
| Molecular Formula | C11H13ClF3N3O |
| Molecular Weight | 295.69 g/mol |
| Exact Mass | 295.07 |
| IUPAC Name | [1-[6-chloro-2-(trifluoromethyl)pyrimidin-4-yl]piperidin-3-yl]methanol |
| SMILES | OCC1CCCN(c2cc(Cl)nc(C(F)(F)F)n2)C1 |
| InChI | InChI=1S/C11H13ClF3N3O/c12-8-4-9(17-10(16-8)11(13,14)15)18-3-1-2-7(5-18)6-19/h4,7,19H,1-3,5-6H2 |
| InChIKey | PVTFFEHVQWONEY-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.69 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |