C11H13ClF3N3 — CID 106767719
6-chloro-N-(cyclobutylmethyl)-N-methyl-2-(trifluoromethyl)pyrimidin-4-amine (PubChem CID 106767719) has the molecular formula C11H13ClF3N3 and a molecular weight of 279.69 g/mol. Its IUPAC name is 6-chloro-N-(cyclobutylmethyl)-N-methyl-2-(trifluoromethyl)pyrimidin-4-amine.
| Compound Name | 6-chloro-N-(cyclobutylmethyl)-N-methyl-2-(trifluoromethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 106767719 |
| Molecular Formula | C11H13ClF3N3 |
| Molecular Weight | 279.69 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | 6-chloro-N-(cyclobutylmethyl)-N-methyl-2-(trifluoromethyl)pyrimidin-4-amine |
| SMILES | CN(CC1CCC1)c1cc(Cl)nc(C(F)(F)F)n1 |
| InChI | InChI=1S/C11H13ClF3N3/c1-18(6-7-3-2-4-7)9-5-8(12)16-10(17-9)11(13,14)15/h5,7H,2-4,6H2,1H3 |
| InChIKey | SMLYPOQOJJXBRG-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.69 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |