C10H8ClF3N4O2 — CID 106768014
4-[6-chloro-2-(trifluoromethyl)pyrimidin-4-yl]-3-methylpiperazine-2,6-dione (PubChem CID 106768014) has the molecular formula C10H8ClF3N4O2 and a molecular weight of 308.65 g/mol. Its IUPAC name is 4-[6-chloro-2-(trifluoromethyl)pyrimidin-4-yl]-3-methylpiperazine-2,6-dione.
| Compound Name | 4-[6-chloro-2-(trifluoromethyl)pyrimidin-4-yl]-3-methylpiperazine-2,6-dione |
|---|---|
| PubChem CID | 106768014 |
| Molecular Formula | C10H8ClF3N4O2 |
| Molecular Weight | 308.65 g/mol |
| Exact Mass | 308.03 |
| IUPAC Name | 4-[6-chloro-2-(trifluoromethyl)pyrimidin-4-yl]-3-methylpiperazine-2,6-dione |
| SMILES | CC1C(=O)NC(=O)CN1c1cc(Cl)nc(C(F)(F)F)n1 |
| InChI | InChI=1S/C10H8ClF3N4O2/c1-4-8(20)17-7(19)3-18(4)6-2-5(11)15-9(16-6)10(12,13)14/h2,4H,3H2,1H3,(H,17,19,20) |
| InChIKey | XZASFRZYNZTBBX-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.65 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|