About 4-chloro-6-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]-2-(trifluoromethyl)pyrimidine
4-chloro-6-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]-2-(trifluoromethyl)pyrimidine (PubChem CID 106768775) has the molecular formula C8H5ClF3N5S
and a molecular weight of 295.68 g/mol. Its IUPAC name is 4-chloro-6-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]-2-(trifluoromethyl)pyrimidine.
Molecular Properties
| Compound Name | 4-chloro-6-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]-2-(trifluoromethyl)pyrimidine |
| PubChem CID | 106768775 |
| Molecular Formula | C8H5ClF3N5S |
| Molecular Weight | 295.68 g/mol |
| Exact Mass | 294.99 |
| IUPAC Name | 4-chloro-6-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]-2-(trifluoromethyl)pyrimidine |
| SMILES | Cn1ncnc1Sc1cc(Cl)nc(C(F)(F)F)n1 |
| InChI | InChI=1S/C8H5ClF3N5S/c1-17-7(13-3-14-17)18-5-2-4(9)15-6(16-5)8(10,11)12/h2-3H,1H3 |
| InChIKey | ADLRAULVMZUSHM-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.68 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-chloro-6-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]-2-(trifluoromethyl)pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-6-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]-2-(trifluoromethyl)pyrimidine?
The IUPAC name of 4-chloro-6-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]-2-(trifluoromethyl)pyrimidine (CID 106768775) is 4-chloro-6-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]-2-(trifluoromethyl)pyrimidine.
What is the SMILES notation for 4-chloro-6-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]-2-(trifluoromethyl)pyrimidine?
The canonical SMILES for 4-chloro-6-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]-2-(trifluoromethyl)pyrimidine is Cn1ncnc1Sc1cc(Cl)nc(C(F)(F)F)n1.
What is the InChIKey of 4-chloro-6-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]-2-(trifluoromethyl)pyrimidine?
The InChIKey is ADLRAULVMZUSHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5ClF3N5S/c1-17-7(13-3-14-17)18-5-2-4(9)15-6(16-5)8(10,11)12/h2-3H,1H3.
What are the key properties of 4-chloro-6-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]-2-(trifluoromethyl)pyrimidine?
4-chloro-6-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]-2-(trifluoromethyl)pyrimidine has a molecular weight of 295.68 g/mol, XLogP of 2.43, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-6-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]-2-(trifluoromethyl)pyrimidine is sourced from PubChem (CID 106768775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).