C11H3ClF6N2 — CID 106768991
4-chloro-2-(trifluoromethyl)-6-(2,4,5-trifluorophenyl)pyrimidine (PubChem CID 106768991) has the molecular formula C11H3ClF6N2 and a molecular weight of 312.60 g/mol. Its IUPAC name is 4-chloro-2-(trifluoromethyl)-6-(2,4,5-trifluorophenyl)pyrimidine.
| Compound Name | 4-chloro-2-(trifluoromethyl)-6-(2,4,5-trifluorophenyl)pyrimidine |
|---|---|
| PubChem CID | 106768991 |
| Molecular Formula | C11H3ClF6N2 |
| Molecular Weight | 312.60 g/mol |
| Exact Mass | 311.99 |
| IUPAC Name | 4-chloro-2-(trifluoromethyl)-6-(2,4,5-trifluorophenyl)pyrimidine |
| SMILES | Fc1cc(F)c(-c2cc(Cl)nc(C(F)(F)F)n2)cc1F |
| InChI | InChI=1S/C11H3ClF6N2/c12-9-3-8(19-10(20-9)11(16,17)18)4-1-6(14)7(15)2-5(4)13/h1-3H |
| InChIKey | MLBNJSOBTXBWTO-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.60 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|