C13H12F3N3O — CID 106769157
6-(2-methoxyphenyl)-N-methyl-2-(trifluoromethyl)pyrimidin-4-amine (PubChem CID 106769157) has the molecular formula C13H12F3N3O and a molecular weight of 283.25 g/mol. Its IUPAC name is 6-(2-methoxyphenyl)-N-methyl-2-(trifluoromethyl)pyrimidin-4-amine.
| Compound Name | 6-(2-methoxyphenyl)-N-methyl-2-(trifluoromethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 106769157 |
| Molecular Formula | C13H12F3N3O |
| Molecular Weight | 283.25 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | 6-(2-methoxyphenyl)-N-methyl-2-(trifluoromethyl)pyrimidin-4-amine |
| SMILES | CNc1cc(-c2ccccc2OC)nc(C(F)(F)F)n1 |
| InChI | InChI=1S/C13H12F3N3O/c1-17-11-7-9(18-12(19-11)13(14,15)16)8-5-3-4-6-10(8)20-2/h3-7H,1-2H3,(H,17,18,19) |
| InChIKey | LXPDHPBNFYKXNA-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.25 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |