C11H9BrF3N3S — CID 106769719
6-(3-bromothiophen-2-yl)-N-ethyl-2-(trifluoromethyl)pyrimidin-4-amine (PubChem CID 106769719) has the molecular formula C11H9BrF3N3S and a molecular weight of 352.18 g/mol. Its IUPAC name is 6-(3-bromothiophen-2-yl)-N-ethyl-2-(trifluoromethyl)pyrimidin-4-amine.
| Compound Name | 6-(3-bromothiophen-2-yl)-N-ethyl-2-(trifluoromethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 106769719 |
| Molecular Formula | C11H9BrF3N3S |
| Molecular Weight | 352.18 g/mol |
| Exact Mass | 350.97 |
| IUPAC Name | 6-(3-bromothiophen-2-yl)-N-ethyl-2-(trifluoromethyl)pyrimidin-4-amine |
| SMILES | CCNc1cc(-c2sccc2Br)nc(C(F)(F)F)n1 |
| InChI | InChI=1S/C11H9BrF3N3S/c1-2-16-8-5-7(9-6(12)3-4-19-9)17-10(18-8)11(13,14)15/h3-5H,2H2,1H3,(H,16,17,18) |
| InChIKey | XFPWZWUXGBCALZ-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.18 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |