C12H11F3N4O — CID 106769781
6-(5-ethoxy-3-pyridinyl)-2-(trifluoromethyl)pyrimidin-4-amine (PubChem CID 106769781) has the molecular formula C12H11F3N4O and a molecular weight of 284.24 g/mol. Its IUPAC name is 6-(5-ethoxy-3-pyridinyl)-2-(trifluoromethyl)pyrimidin-4-amine.
| Compound Name | 6-(5-ethoxy-3-pyridinyl)-2-(trifluoromethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 106769781 |
| Molecular Formula | C12H11F3N4O |
| Molecular Weight | 284.24 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | 6-(5-ethoxy-3-pyridinyl)-2-(trifluoromethyl)pyrimidin-4-amine |
| SMILES | CCOc1cncc(-c2cc(N)nc(C(F)(F)F)n2)c1 |
| InChI | InChI=1S/C12H11F3N4O/c1-2-20-8-3-7(5-17-6-8)9-4-10(16)19-11(18-9)12(13,14)15/h3-6H,2H2,1H3,(H2,16,18,19) |
| InChIKey | DZNIXGFHXIEGAV-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 73.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.24 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |