About 2-[[6-(ethylamino)-2-(trifluoromethyl)pyrimidin-4-yl]amino]-N,N-dimethylpropanamide
2-[[6-(ethylamino)-2-(trifluoromethyl)pyrimidin-4-yl]amino]-N,N-dimethylpropanamide (PubChem CID 106771184) has the molecular formula C12H18F3N5O
and a molecular weight of 305.30 g/mol. Its IUPAC name is 2-[[6-(ethylamino)-2-(trifluoromethyl)pyrimidin-4-yl]amino]-N,N-dimethylpropanamide.
Molecular Properties
| Compound Name | 2-[[6-(ethylamino)-2-(trifluoromethyl)pyrimidin-4-yl]amino]-N,N-dimethylpropanamide |
| PubChem CID | 106771184 |
| Molecular Formula | C12H18F3N5O |
| Molecular Weight | 305.30 g/mol |
| Exact Mass | 305.15 |
| IUPAC Name | 2-[[6-(ethylamino)-2-(trifluoromethyl)pyrimidin-4-yl]amino]-N,N-dimethylpropanamide |
| SMILES | CCNc1cc(NC(C)C(=O)N(C)C)nc(C(F)(F)F)n1 |
| InChI | InChI=1S/C12H18F3N5O/c1-5-16-8-6-9(17-7(2)10(21)20(3)4)19-11(18-8)12(13,14)15/h6-7H,5H2,1-4H3,(H2,16,17,18,19) |
| InChIKey | SRBPECFGMCBXFR-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.30 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[[6-(ethylamino)-2-(trifluoromethyl)pyrimidin-4-yl]amino]-N,N-dimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[6-(ethylamino)-2-(trifluoromethyl)pyrimidin-4-yl]amino]-N,N-dimethylpropanamide?
The IUPAC name of 2-[[6-(ethylamino)-2-(trifluoromethyl)pyrimidin-4-yl]amino]-N,N-dimethylpropanamide (CID 106771184) is 2-[[6-(ethylamino)-2-(trifluoromethyl)pyrimidin-4-yl]amino]-N,N-dimethylpropanamide.
What is the SMILES notation for 2-[[6-(ethylamino)-2-(trifluoromethyl)pyrimidin-4-yl]amino]-N,N-dimethylpropanamide?
The canonical SMILES for 2-[[6-(ethylamino)-2-(trifluoromethyl)pyrimidin-4-yl]amino]-N,N-dimethylpropanamide is CCNc1cc(NC(C)C(=O)N(C)C)nc(C(F)(F)F)n1.
What is the InChIKey of 2-[[6-(ethylamino)-2-(trifluoromethyl)pyrimidin-4-yl]amino]-N,N-dimethylpropanamide?
The InChIKey is SRBPECFGMCBXFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18F3N5O/c1-5-16-8-6-9(17-7(2)10(21)20(3)4)19-11(18-8)12(13,14)15/h6-7H,5H2,1-4H3,(H2,16,17,18,19).
What are the key properties of 2-[[6-(ethylamino)-2-(trifluoromethyl)pyrimidin-4-yl]amino]-N,N-dimethylpropanamide?
2-[[6-(ethylamino)-2-(trifluoromethyl)pyrimidin-4-yl]amino]-N,N-dimethylpropanamide has a molecular weight of 305.30 g/mol, XLogP of 1.82, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[6-(ethylamino)-2-(trifluoromethyl)pyrimidin-4-yl]amino]-N,N-dimethylpropanamide is sourced from PubChem (CID 106771184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).