C13H13F3N4O — CID 106771905
2-[[6-amino-2-(trifluoromethyl)pyrimidin-4-yl]amino]-2-phenylethanol (PubChem CID 106771905) has the molecular formula C13H13F3N4O and a molecular weight of 298.27 g/mol. Its IUPAC name is 2-[[6-amino-2-(trifluoromethyl)pyrimidin-4-yl]amino]-2-phenylethanol.
| Compound Name | 2-[[6-amino-2-(trifluoromethyl)pyrimidin-4-yl]amino]-2-phenylethanol |
|---|---|
| PubChem CID | 106771905 |
| Molecular Formula | C13H13F3N4O |
| Molecular Weight | 298.27 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | 2-[[6-amino-2-(trifluoromethyl)pyrimidin-4-yl]amino]-2-phenylethanol |
| SMILES | Nc1cc(NC(CO)c2ccccc2)nc(C(F)(F)F)n1 |
| InChI | InChI=1S/C13H13F3N4O/c14-13(15,16)12-19-10(17)6-11(20-12)18-9(7-21)8-4-2-1-3-5-8/h1-6,9,21H,7H2,(H3,17,18,19,20) |
| InChIKey | VRQVNWWQAMGSKM-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.27 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |