C48H42O6S6 — CID 10677202
1,2,3,4,5,6-hexakis[(4-methoxyphenyl)sulfanyl]benzene (PubChem CID 10677202) has the molecular formula C48H42O6S6 and a molecular weight of 907.26 g/mol. Its IUPAC name is 1,2,3,4,5,6-hexakis[(4-methoxyphenyl)sulfanyl]benzene.
| Compound Name | 1,2,3,4,5,6-hexakis[(4-methoxyphenyl)sulfanyl]benzene |
|---|---|
| PubChem CID | 10677202 |
| Molecular Formula | C48H42O6S6 |
| Molecular Weight | 907.26 g/mol |
| Exact Mass | 906.13 |
| IUPAC Name | 1,2,3,4,5,6-hexakis[(4-methoxyphenyl)sulfanyl]benzene |
| SMILES | COc1ccc(Sc2c(Sc3ccc(OC)cc3)c(Sc3ccc(OC)cc3)c(Sc3ccc(OC)cc3)c(Sc3ccc(OC)cc3)c2Sc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C48H42O6S6/c1-49-31-7-19-37(20-8-31)55-43-44(56-38-21-9-32(50-2)10-22-38)46(58-40-25-13-34(52-4)14-26-40)48(60-42-29-17-36(54-6)18-30-42)47(59-41-27-15-35(53-5)16-28-41)45(43)57-39-23-11-33(51-3)12-24-39/h7-30H,1-6H3 |
| InChIKey | FISKUFQQYRGZJK-UHFFFAOYSA-N |
| XLogP | 14.65 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 907.26 |
| LogP ≤ 5 | 14.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |