C11H12F3N5O2 — CID 106772364
3-[[6-amino-2-(trifluoromethyl)pyrimidin-4-yl]amino]-1-methylpiperidine-2,6-dione (PubChem CID 106772364) has the molecular formula C11H12F3N5O2 and a molecular weight of 303.24 g/mol. Its IUPAC name is 3-[[6-amino-2-(trifluoromethyl)pyrimidin-4-yl]amino]-1-methylpiperidine-2,6-dione.
| Compound Name | 3-[[6-amino-2-(trifluoromethyl)pyrimidin-4-yl]amino]-1-methylpiperidine-2,6-dione |
|---|---|
| PubChem CID | 106772364 |
| Molecular Formula | C11H12F3N5O2 |
| Molecular Weight | 303.24 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | 3-[[6-amino-2-(trifluoromethyl)pyrimidin-4-yl]amino]-1-methylpiperidine-2,6-dione |
| SMILES | CN1C(=O)CCC(Nc2cc(N)nc(C(F)(F)F)n2)C1=O |
| InChI | InChI=1S/C11H12F3N5O2/c1-19-8(20)3-2-5(9(19)21)16-7-4-6(15)17-10(18-7)11(12,13)14/h4-5H,2-3H2,1H3,(H3,15,16,17,18) |
| InChIKey | HRIXPDAMDFAZAA-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 101.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.24 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|