About CID 10677238
CID 10677238 (PubChem CID 10677238) has the molecular formula C59H56N5OZn
and a molecular weight of 916.52 g/mol.
Molecular Properties
| Compound Name | CID 10677238 |
| PubChem CID | 10677238 |
| Molecular Formula | C59H56N5OZn |
| Molecular Weight | 916.52 g/mol |
| Exact Mass | 914.38 |
| IUPAC Name | — |
| SMILES | Cc1cc(C)c(-c2c3nc(c(-c4c(C)cc(C)cc4C)c4ccc([n-]4)c(-c4c(C)cc(C)cc4C)c4nc(c(/C=C/c5ccc(N([O])C(C)(C)C)cc5)c5ccc2[n-]5)C=C4)C=C3)c(C)c1.[Zn+2] |
| InChI | InChI=1S/C59H56N5O.Zn/c1-33-27-36(4)53(37(5)28-33)56-47-21-19-45(60-47)44(18-15-42-13-16-43(17-14-42)64(65)59(10,11)12)46-20-22-48(61-46)57(54-38(6)29-34(2)30-39(54)7)50-24-26-52(63-50)58(51-25-23-49(56)62-51)55-40(8)31-35(3)32-41(55)9;/h13-32H,1-12H3;/q-2;+2/b18-15+,45-44-,46-44-,56-47+,56-49+,57-48+,57-50+,58-51+,58-52+; |
| InChIKey | IPWSUBKUQASMCC-HGRYAZFSSA-N |
| XLogP | 14.81 |
| TPSA | 77.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 66 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 916.52 |
| LogP ≤ 5 | 14.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 10677238 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 10677238?
The IUPAC name of CID 10677238 (CID 10677238) is not available.
What is the SMILES notation for CID 10677238?
The canonical SMILES for CID 10677238 is Cc1cc(C)c(-c2c3nc(c(-c4c(C)cc(C)cc4C)c4ccc([n-]4)c(-c4c(C)cc(C)cc4C)c4nc(c(/C=C/c5ccc(N([O])C(C)(C)C)cc5)c5ccc2[n-]5)C=C4)C=C3)c(C)c1.[Zn+2].
What is the InChIKey of CID 10677238?
The InChIKey is IPWSUBKUQASMCC-HGRYAZFSSA-N. The full InChI is InChI=1S/C59H56N5O.Zn/c1-33-27-36(4)53(37(5)28-33)56-47-21-19-45(60-47)44(18-15-42-13-16-43(17-14-42)64(65)59(10,11)12)46-20-22-48(61-46)57(54-38(6)29-34(2)30-39(54)7)50-24-26-52(63-50)58(51-25-23-49(56)62-51)55-40(8)31-35(3)32-41(55)9;/h13-32H,1-12H3;/q-2;+2/b18-15+,45-44-,46-44-,56-47+,56-49+,57-48+,57-50+,58-51+,58-52+;.
What are the key properties of CID 10677238?
CID 10677238 has a molecular weight of 916.52 g/mol, XLogP of 14.81, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 10677238 is sourced from PubChem (CID 10677238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).