About 1-[6-(propylamino)-2-(trifluoromethyl)pyrimidin-4-yl]pyrrolidine-3,4-diol
1-[6-(propylamino)-2-(trifluoromethyl)pyrimidin-4-yl]pyrrolidine-3,4-diol (PubChem CID 106773424) has the molecular formula C12H17F3N4O2
and a molecular weight of 306.29 g/mol. Its IUPAC name is 1-[6-(propylamino)-2-(trifluoromethyl)pyrimidin-4-yl]pyrrolidine-3,4-diol.
Molecular Properties
| Compound Name | 1-[6-(propylamino)-2-(trifluoromethyl)pyrimidin-4-yl]pyrrolidine-3,4-diol |
| PubChem CID | 106773424 |
| Molecular Formula | C12H17F3N4O2 |
| Molecular Weight | 306.29 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | 1-[6-(propylamino)-2-(trifluoromethyl)pyrimidin-4-yl]pyrrolidine-3,4-diol |
| SMILES | CCCNc1cc(N2CC(O)C(O)C2)nc(C(F)(F)F)n1 |
| InChI | InChI=1S/C12H17F3N4O2/c1-2-3-16-9-4-10(18-11(17-9)12(13,14)15)19-5-7(20)8(21)6-19/h4,7-8,20-21H,2-3,5-6H2,1H3,(H,16,17,18) |
| InChIKey | IQJVACFGLXAVDH-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.29 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[6-(propylamino)-2-(trifluoromethyl)pyrimidin-4-yl]pyrrolidine-3,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[6-(propylamino)-2-(trifluoromethyl)pyrimidin-4-yl]pyrrolidine-3,4-diol?
The IUPAC name of 1-[6-(propylamino)-2-(trifluoromethyl)pyrimidin-4-yl]pyrrolidine-3,4-diol (CID 106773424) is 1-[6-(propylamino)-2-(trifluoromethyl)pyrimidin-4-yl]pyrrolidine-3,4-diol.
What is the SMILES notation for 1-[6-(propylamino)-2-(trifluoromethyl)pyrimidin-4-yl]pyrrolidine-3,4-diol?
The canonical SMILES for 1-[6-(propylamino)-2-(trifluoromethyl)pyrimidin-4-yl]pyrrolidine-3,4-diol is CCCNc1cc(N2CC(O)C(O)C2)nc(C(F)(F)F)n1.
What is the InChIKey of 1-[6-(propylamino)-2-(trifluoromethyl)pyrimidin-4-yl]pyrrolidine-3,4-diol?
The InChIKey is IQJVACFGLXAVDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17F3N4O2/c1-2-3-16-9-4-10(18-11(17-9)12(13,14)15)19-5-7(20)8(21)6-19/h4,7-8,20-21H,2-3,5-6H2,1H3,(H,16,17,18).
What are the key properties of 1-[6-(propylamino)-2-(trifluoromethyl)pyrimidin-4-yl]pyrrolidine-3,4-diol?
1-[6-(propylamino)-2-(trifluoromethyl)pyrimidin-4-yl]pyrrolidine-3,4-diol has a molecular weight of 306.29 g/mol, XLogP of 0.86, 4 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[6-(propylamino)-2-(trifluoromethyl)pyrimidin-4-yl]pyrrolidine-3,4-diol is sourced from PubChem (CID 106773424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).