C10H20N2O2 — CID 106774167
(3R)-N-tert-butyl-3-methylmorpholine-4-carboxamide (PubChem CID 106774167) has the molecular formula C10H20N2O2 and a molecular weight of 200.28 g/mol. Its IUPAC name is (3R)-N-tert-butyl-3-methylmorpholine-4-carboxamide.
| Compound Name | (3R)-N-tert-butyl-3-methylmorpholine-4-carboxamide |
|---|---|
| PubChem CID | 106774167 |
| Molecular Formula | C10H20N2O2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.15 |
| IUPAC Name | (3R)-N-tert-butyl-3-methylmorpholine-4-carboxamide |
| SMILES | C[C@@H]1COCCN1C(=O)NC(C)(C)C |
| InChI | InChI=1S/C10H20N2O2/c1-8-7-14-6-5-12(8)9(13)11-10(2,3)4/h8H,5-7H2,1-4H3,(H,11,13)/t8-/m1/s1 |
| InChIKey | NHNDLCQQKRGZIX-MRVPVSSYSA-N |
| XLogP | 1.22 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |