C14H16N4O3 — CID 106774564
(3,4-dihydroxypyrrolidin-1-yl)-(1-hydrazinylisoquinolin-4-yl)methanone (PubChem CID 106774564) has the molecular formula C14H16N4O3 and a molecular weight of 288.31 g/mol. Its IUPAC name is (3,4-dihydroxypyrrolidin-1-yl)-(1-hydrazinylisoquinolin-4-yl)methanone.
| Compound Name | (3,4-dihydroxypyrrolidin-1-yl)-(1-hydrazinylisoquinolin-4-yl)methanone |
|---|---|
| PubChem CID | 106774564 |
| Molecular Formula | C14H16N4O3 |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | (3,4-dihydroxypyrrolidin-1-yl)-(1-hydrazinylisoquinolin-4-yl)methanone |
| SMILES | NNc1ncc(C(=O)N2CC(O)C(O)C2)c2ccccc12 |
| InChI | InChI=1S/C14H16N4O3/c15-17-13-9-4-2-1-3-8(9)10(5-16-13)14(21)18-6-11(19)12(20)7-18/h1-5,11-12,19-20H,6-7,15H2,(H,16,17) |
| InChIKey | UYNIGLRJQTZTQX-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 111.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|