C15H17N3O2 — CID 106774608
(4-aminoquinolin-2-yl)-[(3R)-3-methylmorpholin-4-yl]methanone (PubChem CID 106774608) has the molecular formula C15H17N3O2 and a molecular weight of 271.32 g/mol. Its IUPAC name is (4-aminoquinolin-2-yl)-[(3R)-3-methylmorpholin-4-yl]methanone.
| Compound Name | (4-aminoquinolin-2-yl)-[(3R)-3-methylmorpholin-4-yl]methanone |
|---|---|
| PubChem CID | 106774608 |
| Molecular Formula | C15H17N3O2 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.13 |
| IUPAC Name | (4-aminoquinolin-2-yl)-[(3R)-3-methylmorpholin-4-yl]methanone |
| SMILES | C[C@@H]1COCCN1C(=O)c1cc(N)c2ccccc2n1 |
| InChI | InChI=1S/C15H17N3O2/c1-10-9-20-7-6-18(10)15(19)14-8-12(16)11-4-2-3-5-13(11)17-14/h2-5,8,10H,6-7,9H2,1H3,(H2,16,17)/t10-/m1/s1 |
| InChIKey | SOEMFWGEQAIASR-SNVBAGLBSA-N |
| XLogP | 1.68 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |