C11H12F3N5O — CID 106774799
N-ethyl-6-(1-methylpyrazol-4-yl)oxy-2-(trifluoromethyl)pyrimidin-4-amine (PubChem CID 106774799) has the molecular formula C11H12F3N5O and a molecular weight of 287.25 g/mol. Its IUPAC name is N-ethyl-6-(1-methylpyrazol-4-yl)oxy-2-(trifluoromethyl)pyrimidin-4-amine.
| Compound Name | N-ethyl-6-(1-methylpyrazol-4-yl)oxy-2-(trifluoromethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 106774799 |
| Molecular Formula | C11H12F3N5O |
| Molecular Weight | 287.25 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | N-ethyl-6-(1-methylpyrazol-4-yl)oxy-2-(trifluoromethyl)pyrimidin-4-amine |
| SMILES | CCNc1cc(Oc2cnn(C)c2)nc(C(F)(F)F)n1 |
| InChI | InChI=1S/C11H12F3N5O/c1-3-15-8-4-9(18-10(17-8)11(12,13)14)20-7-5-16-19(2)6-7/h4-6H,3H2,1-2H3,(H,15,17,18) |
| InChIKey | ZRTQJJFJFSGTAQ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.25 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |