About 6-(4,4-dimethylcyclohexyl)oxy-N-methyl-2-(trifluoromethyl)pyrimidin-4-amine
6-(4,4-dimethylcyclohexyl)oxy-N-methyl-2-(trifluoromethyl)pyrimidin-4-amine (PubChem CID 106774808) has the molecular formula C14H20F3N3O
and a molecular weight of 303.33 g/mol. Its IUPAC name is 6-(4,4-dimethylcyclohexyl)oxy-N-methyl-2-(trifluoromethyl)pyrimidin-4-amine.
Molecular Properties
| Compound Name | 6-(4,4-dimethylcyclohexyl)oxy-N-methyl-2-(trifluoromethyl)pyrimidin-4-amine |
| PubChem CID | 106774808 |
| Molecular Formula | C14H20F3N3O |
| Molecular Weight | 303.33 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | 6-(4,4-dimethylcyclohexyl)oxy-N-methyl-2-(trifluoromethyl)pyrimidin-4-amine |
| SMILES | CNc1cc(OC2CCC(C)(C)CC2)nc(C(F)(F)F)n1 |
| InChI | InChI=1S/C14H20F3N3O/c1-13(2)6-4-9(5-7-13)21-11-8-10(18-3)19-12(20-11)14(15,16)17/h8-9H,4-7H2,1-3H3,(H,18,19,20) |
| InChIKey | KQPAPWZHTBTKIU-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.33 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-(4,4-dimethylcyclohexyl)oxy-N-methyl-2-(trifluoromethyl)pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(4,4-dimethylcyclohexyl)oxy-N-methyl-2-(trifluoromethyl)pyrimidin-4-amine?
The IUPAC name of 6-(4,4-dimethylcyclohexyl)oxy-N-methyl-2-(trifluoromethyl)pyrimidin-4-amine (CID 106774808) is 6-(4,4-dimethylcyclohexyl)oxy-N-methyl-2-(trifluoromethyl)pyrimidin-4-amine.
What is the SMILES notation for 6-(4,4-dimethylcyclohexyl)oxy-N-methyl-2-(trifluoromethyl)pyrimidin-4-amine?
The canonical SMILES for 6-(4,4-dimethylcyclohexyl)oxy-N-methyl-2-(trifluoromethyl)pyrimidin-4-amine is CNc1cc(OC2CCC(C)(C)CC2)nc(C(F)(F)F)n1.
What is the InChIKey of 6-(4,4-dimethylcyclohexyl)oxy-N-methyl-2-(trifluoromethyl)pyrimidin-4-amine?
The InChIKey is KQPAPWZHTBTKIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20F3N3O/c1-13(2)6-4-9(5-7-13)21-11-8-10(18-3)19-12(20-11)14(15,16)17/h8-9H,4-7H2,1-3H3,(H,18,19,20).
What are the key properties of 6-(4,4-dimethylcyclohexyl)oxy-N-methyl-2-(trifluoromethyl)pyrimidin-4-amine?
6-(4,4-dimethylcyclohexyl)oxy-N-methyl-2-(trifluoromethyl)pyrimidin-4-amine has a molecular weight of 303.33 g/mol, XLogP of 3.88, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4,4-dimethylcyclohexyl)oxy-N-methyl-2-(trifluoromethyl)pyrimidin-4-amine is sourced from PubChem (CID 106774808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).