C9H6F3N5OS — CID 106774921
2-[6-amino-2-(trifluoromethyl)pyrimidin-4-yl]sulfanyl-1H-pyrimidin-6-one (PubChem CID 106774921) has the molecular formula C9H6F3N5OS and a molecular weight of 289.24 g/mol. Its IUPAC name is 2-[6-amino-2-(trifluoromethyl)pyrimidin-4-yl]sulfanyl-1H-pyrimidin-6-one.
| Compound Name | 2-[6-amino-2-(trifluoromethyl)pyrimidin-4-yl]sulfanyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 106774921 |
| Molecular Formula | C9H6F3N5OS |
| Molecular Weight | 289.24 g/mol |
| Exact Mass | 289.02 |
| IUPAC Name | 2-[6-amino-2-(trifluoromethyl)pyrimidin-4-yl]sulfanyl-1H-pyrimidin-6-one |
| SMILES | Nc1cc(Sc2nccc(=O)[nH]2)nc(C(F)(F)F)n1 |
| InChI | InChI=1S/C9H6F3N5OS/c10-9(11,12)7-15-4(13)3-6(17-7)19-8-14-2-1-5(18)16-8/h1-3H,(H2,13,15,17)(H,14,16,18) |
| InChIKey | AFWLZFABQLYAOS-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 97.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.24 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |