About N-propyl-6-(1,3-thiazol-2-ylsulfanyl)-2-(trifluoromethyl)pyrimidin-4-amine
N-propyl-6-(1,3-thiazol-2-ylsulfanyl)-2-(trifluoromethyl)pyrimidin-4-amine (PubChem CID 106775076) has the molecular formula C11H11F3N4S2
and a molecular weight of 320.37 g/mol. Its IUPAC name is N-propyl-6-(1,3-thiazol-2-ylsulfanyl)-2-(trifluoromethyl)pyrimidin-4-amine.
Molecular Properties
| Compound Name | N-propyl-6-(1,3-thiazol-2-ylsulfanyl)-2-(trifluoromethyl)pyrimidin-4-amine |
| PubChem CID | 106775076 |
| Molecular Formula | C11H11F3N4S2 |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.04 |
| IUPAC Name | N-propyl-6-(1,3-thiazol-2-ylsulfanyl)-2-(trifluoromethyl)pyrimidin-4-amine |
| SMILES | CCCNc1cc(Sc2nccs2)nc(C(F)(F)F)n1 |
| InChI | InChI=1S/C11H11F3N4S2/c1-2-3-15-7-6-8(20-10-16-4-5-19-10)18-9(17-7)11(12,13)14/h4-6H,2-3H2,1H3,(H,15,17,18) |
| InChIKey | UYAQBNZOVCLOPI-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|
Analyze N-propyl-6-(1,3-thiazol-2-ylsulfanyl)-2-(trifluoromethyl)pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-propyl-6-(1,3-thiazol-2-ylsulfanyl)-2-(trifluoromethyl)pyrimidin-4-amine?
The IUPAC name of N-propyl-6-(1,3-thiazol-2-ylsulfanyl)-2-(trifluoromethyl)pyrimidin-4-amine (CID 106775076) is N-propyl-6-(1,3-thiazol-2-ylsulfanyl)-2-(trifluoromethyl)pyrimidin-4-amine.
What is the SMILES notation for N-propyl-6-(1,3-thiazol-2-ylsulfanyl)-2-(trifluoromethyl)pyrimidin-4-amine?
The canonical SMILES for N-propyl-6-(1,3-thiazol-2-ylsulfanyl)-2-(trifluoromethyl)pyrimidin-4-amine is CCCNc1cc(Sc2nccs2)nc(C(F)(F)F)n1.
What is the InChIKey of N-propyl-6-(1,3-thiazol-2-ylsulfanyl)-2-(trifluoromethyl)pyrimidin-4-amine?
The InChIKey is UYAQBNZOVCLOPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11F3N4S2/c1-2-3-15-7-6-8(20-10-16-4-5-19-10)18-9(17-7)11(12,13)14/h4-6H,2-3H2,1H3,(H,15,17,18).
What are the key properties of N-propyl-6-(1,3-thiazol-2-ylsulfanyl)-2-(trifluoromethyl)pyrimidin-4-amine?
N-propyl-6-(1,3-thiazol-2-ylsulfanyl)-2-(trifluoromethyl)pyrimidin-4-amine has a molecular weight of 320.37 g/mol, XLogP of 3.92, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-propyl-6-(1,3-thiazol-2-ylsulfanyl)-2-(trifluoromethyl)pyrimidin-4-amine is sourced from PubChem (CID 106775076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).